C26H35BClNO6 — CID 90943890
4-chloro-2-(4-hydroxybutoxy)-N-[(2-methoxy-6-methylphenyl)methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (PubChem CID 90943890) has the molecular formula C26H35BClNO6 and a molecular weight of 503.83 g/mol. Its IUPAC name is 4-chloro-2-(4-hydroxybutoxy)-N-[(2-methoxy-6-methylphenyl)methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide.
| Compound Name | 4-chloro-2-(4-hydroxybutoxy)-N-[(2-methoxy-6-methylphenyl)methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
|---|---|
| PubChem CID | 90943890 |
| Molecular Formula | C26H35BClNO6 |
| Molecular Weight | 503.83 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | 4-chloro-2-(4-hydroxybutoxy)-N-[(2-methoxy-6-methylphenyl)methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| SMILES | COc1cccc(C)c1CNC(=O)c1cc(B2OC(C)(C)C(C)(C)O2)c(Cl)cc1OCCCCO |
| InChI | InChI=1S/C26H35BClNO6/c1-17-10-9-11-22(32-6)19(17)16-29-24(31)18-14-20(27-34-25(2,3)26(4,5)35-27)21(28)15-23(18)33-13-8-7-12-30/h9-11,14-15,30H,7-8,12-13,16H2,1-6H3,(H,29,31) |
| InChIKey | KMDMJOGYOVUIII-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.83 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|