C19H26O4 — CID 91393468
(3S,8R,9S,10R,13S,14S)-3-hydroxy-10,13-dimethyl-1,2,3,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-4,6,17-trione (PubChem CID 91393468) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is (3S,8R,9S,10R,13S,14S)-3-hydroxy-10,13-dimethyl-1,2,3,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-4,6,17-trione.
| Compound Name | (3S,8R,9S,10R,13S,14S)-3-hydroxy-10,13-dimethyl-1,2,3,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-4,6,17-trione |
|---|---|
| PubChem CID | 91393468 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (3S,8R,9S,10R,13S,14S)-3-hydroxy-10,13-dimethyl-1,2,3,5,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-4,6,17-trione |
| SMILES | C[C@]12CC[C@H](O)C(=O)C1C(=O)C[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C19H26O4/c1-18-7-5-12-10(11(18)3-4-15(18)22)9-14(21)16-17(23)13(20)6-8-19(12,16)2/h10-13,16,20H,3-9H2,1-2H3/t10-,11-,12-,13-,16?,18-,19+/m0/s1 |
| InChIKey | TTXXDQPMSZWJSA-JCFUIANNSA-N |
| XLogP | 2.32 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|