C9H9BrO4S — CID 91394564
5-bromo-4-(2-ethoxy-2-oxoethyl)thiophene-2-carboxylic acid (PubChem CID 91394564) has the molecular formula C9H9BrO4S and a molecular weight of 293.14 g/mol. Its IUPAC name is 5-bromo-4-(2-ethoxy-2-oxoethyl)thiophene-2-carboxylic acid.
| Compound Name | 5-bromo-4-(2-ethoxy-2-oxoethyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 91394564 |
| Molecular Formula | C9H9BrO4S |
| Molecular Weight | 293.14 g/mol |
| Exact Mass | 291.94 |
| IUPAC Name | 5-bromo-4-(2-ethoxy-2-oxoethyl)thiophene-2-carboxylic acid |
| SMILES | CCOC(=O)Cc1cc(C(=O)O)sc1Br |
| InChI | InChI=1S/C9H9BrO4S/c1-2-14-7(11)4-5-3-6(9(12)13)15-8(5)10/h3H,2,4H2,1H3,(H,12,13) |
| InChIKey | JFBQOWKRKDUULZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.14 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |