ethane;2-hydroxy-11H-benzo[a]carbazole-3-carboxylic acid

C19H17NO3 — CID 91394685

IUPACethane;2-hydroxy-11H-benzo[a]carbazole-3-carboxylic acid
SMILESCC.O=C(O)c1cc2ccc3c4ccccc4[nH]c3c2cc1O
InChIInChI=1S/C17H11NO3.C2H6/c19-15-8-12-9(7-13(15)17(20)21)5-6-11-10-3-1-2-4-14(10)18-16(11)12;1-2/h1-8,18-19H,(H,20,21);1-2H3
InChIKeyXCJYWSGYVSNXAX-UHFFFAOYSA-N
MW307.35 g/mol
LogP4.90
Rot. Bonds1

About ethane;2-hydroxy-11H-benzo[a]carbazole-3-carboxylic acid

ethane;2-hydroxy-11H-benzo[a]carbazole-3-carboxylic acid (PubChem CID 91394685) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is ethane;2-hydroxy-11H-benzo[a]carbazole-3-carboxylic acid.

Molecular Properties

Compound Nameethane;2-hydroxy-11H-benzo[a]carbazole-3-carboxylic acid
PubChem CID91394685
Molecular FormulaC19H17NO3
Molecular Weight307.35 g/mol
Exact Mass307.12
IUPAC Nameethane;2-hydroxy-11H-benzo[a]carbazole-3-carboxylic acid
SMILESCC.O=C(O)c1cc2ccc3c4ccccc4[nH]c3c2cc1O
InChIInChI=1S/C17H11NO3.C2H6/c19-15-8-12-9(7-13(15)17(20)21)5-6-11-10-3-1-2-4-14(10)18-16(11)12;1-2/h1-8,18-19H,(H,20,21);1-2H3
InChIKeyXCJYWSGYVSNXAX-UHFFFAOYSA-N
XLogP4.90
TPSA73.32 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500307.35
LogP ≤ 54.90
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Analyze ethane;2-hydroxy-11H-benzo[a]carbazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;2-hydroxy-11H-benzo[a]carbazole-3-carboxylic acid?
The IUPAC name of ethane;2-hydroxy-11H-benzo[a]carbazole-3-carboxylic acid (CID 91394685) is ethane;2-hydroxy-11H-benzo[a]carbazole-3-carboxylic acid.
What is the SMILES notation for ethane;2-hydroxy-11H-benzo[a]carbazole-3-carboxylic acid?
The canonical SMILES for ethane;2-hydroxy-11H-benzo[a]carbazole-3-carboxylic acid is CC.O=C(O)c1cc2ccc3c4ccccc4[nH]c3c2cc1O.
What is the InChIKey of ethane;2-hydroxy-11H-benzo[a]carbazole-3-carboxylic acid?
The InChIKey is XCJYWSGYVSNXAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11NO3.C2H6/c19-15-8-12-9(7-13(15)17(20)21)5-6-11-10-3-1-2-4-14(10)18-16(11)12;1-2/h1-8,18-19H,(H,20,21);1-2H3.
What are the key properties of ethane;2-hydroxy-11H-benzo[a]carbazole-3-carboxylic acid?
ethane;2-hydroxy-11H-benzo[a]carbazole-3-carboxylic acid has a molecular weight of 307.35 g/mol, XLogP of 4.90, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-hydroxy-11H-benzo[a]carbazole-3-carboxylic acid is sourced from PubChem (CID 91394685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).