C24H18N2O2 — CID 14008608
2-hydroxy-N-(3-methylphenyl)-11H-benzo[a]carbazole-3-carboxamide (PubChem CID 14008608) has the molecular formula C24H18N2O2 and a molecular weight of 366.42 g/mol. Its IUPAC name is 2-hydroxy-N-(3-methylphenyl)-11H-benzo[a]carbazole-3-carboxamide.
| Compound Name | 2-hydroxy-N-(3-methylphenyl)-11H-benzo[a]carbazole-3-carboxamide |
|---|---|
| PubChem CID | 14008608 |
| Molecular Formula | C24H18N2O2 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 2-hydroxy-N-(3-methylphenyl)-11H-benzo[a]carbazole-3-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2cc3ccc4c5ccccc5[nH]c4c3cc2O)c1 |
| InChI | InChI=1S/C24H18N2O2/c1-14-5-4-6-16(11-14)25-24(28)20-12-15-9-10-18-17-7-2-3-8-21(17)26-23(18)19(15)13-22(20)27/h2-13,26-27H,1H3,(H,25,28) |
| InChIKey | ZGBGLUBOGOBSCU-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |