C24H16Cl2N8S2 — CID 91396132
1,2-bis(2-chloro-1,7-naphthyridin-8-yl)-1-(2-methyl-1,3-thiazol-4-yl)-2-(4-methyl-1,3-thiazol-2-yl)hydrazine (PubChem CID 91396132) has the molecular formula C24H16Cl2N8S2 and a molecular weight of 551.49 g/mol. Its IUPAC name is 1,2-bis(2-chloro-1,7-naphthyridin-8-yl)-1-(2-methyl-1,3-thiazol-4-yl)-2-(4-methyl-1,3-thiazol-2-yl)hydrazine.
| Compound Name | 1,2-bis(2-chloro-1,7-naphthyridin-8-yl)-1-(2-methyl-1,3-thiazol-4-yl)-2-(4-methyl-1,3-thiazol-2-yl)hydrazine |
|---|---|
| PubChem CID | 91396132 |
| Molecular Formula | C24H16Cl2N8S2 |
| Molecular Weight | 551.49 g/mol |
| Exact Mass | 550.03 |
| IUPAC Name | 1,2-bis(2-chloro-1,7-naphthyridin-8-yl)-1-(2-methyl-1,3-thiazol-4-yl)-2-(4-methyl-1,3-thiazol-2-yl)hydrazine |
| SMILES | Cc1csc(N(c2nccc3ccc(Cl)nc23)N(c2csc(C)n2)c2nccc3ccc(Cl)nc23)n1 |
| InChI | InChI=1S/C24H16Cl2N8S2/c1-13-11-36-24(29-13)34(23-21-16(8-10-28-23)4-6-18(26)32-21)33(19-12-35-14(2)30-19)22-20-15(7-9-27-22)3-5-17(25)31-20/h3-12H,1-2H3 |
| InChIKey | KIYPOIUNLNACRK-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 83.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.49 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|