C22H22FN5O5 — CID 91398620
(2R)-2-[[3-[4-[(2-fluorophenyl)carbamoylamino]phenyl]-1,2-oxazole-5-carboximidoyl]-hydroxyamino]-3-methylbutanoic acid (PubChem CID 91398620) has the molecular formula C22H22FN5O5 and a molecular weight of 455.45 g/mol. Its IUPAC name is (2R)-2-[[3-[4-[(2-fluorophenyl)carbamoylamino]phenyl]-1,2-oxazole-5-carboximidoyl]-hydroxyamino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[[3-[4-[(2-fluorophenyl)carbamoylamino]phenyl]-1,2-oxazole-5-carboximidoyl]-hydroxyamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 91398620 |
| Molecular Formula | C22H22FN5O5 |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | (2R)-2-[[3-[4-[(2-fluorophenyl)carbamoylamino]phenyl]-1,2-oxazole-5-carboximidoyl]-hydroxyamino]-3-methylbutanoic acid |
| SMILES | [H]/N=C(\c1cc(-c2ccc(NC(=O)Nc3ccccc3F)cc2)no1)N(O)[C@@H](C(=O)O)C(C)C |
| InChI | InChI=1S/C22H22FN5O5/c1-12(2)19(21(29)30)28(32)20(24)18-11-17(27-33-18)13-7-9-14(10-8-13)25-22(31)26-16-6-4-3-5-15(16)23/h3-12,19,24,32H,1-2H3,(H,29,30)(H2,25,26,31)/b24-20+/t19-/m1/s1 |
| InChIKey | RSUGAZRISJQOJD-ICBALBMBSA-N |
| XLogP | 4.25 |
| TPSA | 151.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|