C5H8N2O2 — CID 91398721
3-(methylamino)-1H-pyrrole-2,5-diol (PubChem CID 91398721) has the molecular formula C5H8N2O2 and a molecular weight of 128.13 g/mol. Its IUPAC name is 3-(methylamino)-1H-pyrrole-2,5-diol.
| Compound Name | 3-(methylamino)-1H-pyrrole-2,5-diol |
|---|---|
| PubChem CID | 91398721 |
| Molecular Formula | C5H8N2O2 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | 3-(methylamino)-1H-pyrrole-2,5-diol |
| SMILES | CNc1cc(O)[nH]c1O |
| InChI | InChI=1S/C5H8N2O2/c1-6-3-2-4(8)7-5(3)9/h2,6-9H,1H3 |
| InChIKey | XUFMZTRCMXFKFK-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 68.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |