C8H8N2O4 — CID 54353036
1-(2,5-dihydroxy-1H-pyrrol-3-yl)pyrrole-2,5-diol (PubChem CID 54353036) has the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. Its IUPAC name is 1-(2,5-dihydroxy-1H-pyrrol-3-yl)pyrrole-2,5-diol.
| Compound Name | 1-(2,5-dihydroxy-1H-pyrrol-3-yl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 54353036 |
| Molecular Formula | C8H8N2O4 |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 1-(2,5-dihydroxy-1H-pyrrol-3-yl)pyrrole-2,5-diol |
| SMILES | Oc1cc(-n2c(O)ccc2O)c(O)[nH]1 |
| InChI | InChI=1S/C8H8N2O4/c11-5-3-4(8(14)9-5)10-6(12)1-2-7(10)13/h1-3,9,11-14H |
| InChIKey | FGWWMCVSEORPDV-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 101.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.16 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |