C8H12N2O2 — CID 54541041
3-pyrrolidin-1-yl-1H-pyrrole-2,5-diol (PubChem CID 54541041) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 3-pyrrolidin-1-yl-1H-pyrrole-2,5-diol.
| Compound Name | 3-pyrrolidin-1-yl-1H-pyrrole-2,5-diol |
|---|---|
| PubChem CID | 54541041 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 3-pyrrolidin-1-yl-1H-pyrrole-2,5-diol |
| SMILES | Oc1cc(N2CCCC2)c(O)[nH]1 |
| InChI | InChI=1S/C8H12N2O2/c11-7-5-6(8(12)9-7)10-3-1-2-4-10/h5,9,11-12H,1-4H2 |
| InChIKey | GSMWDMYLGJBKSE-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 59.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |