C24H17N3O2S — CID 91398896
3-(4-methoxyphenyl)-2-(4-phenyl-1,3-thiazol-5-yl)quinazolin-4-one (PubChem CID 91398896) has the molecular formula C24H17N3O2S and a molecular weight of 411.49 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-2-(4-phenyl-1,3-thiazol-5-yl)quinazolin-4-one.
| Compound Name | 3-(4-methoxyphenyl)-2-(4-phenyl-1,3-thiazol-5-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 91398896 |
| Molecular Formula | C24H17N3O2S |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 3-(4-methoxyphenyl)-2-(4-phenyl-1,3-thiazol-5-yl)quinazolin-4-one |
| SMILES | COc1ccc(-n2c(-c3scnc3-c3ccccc3)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C24H17N3O2S/c1-29-18-13-11-17(12-14-18)27-23(26-20-10-6-5-9-19(20)24(27)28)22-21(25-15-30-22)16-7-3-2-4-8-16/h2-15H,1H3 |
| InChIKey | APGWYXKDRFAGRI-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |