C26H26N2O3 — CID 24720134
3-(4-butan-2-ylphenyl)-2-(3,5-dimethoxyphenyl)quinazolin-4-one (PubChem CID 24720134) has the molecular formula C26H26N2O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is 3-(4-butan-2-ylphenyl)-2-(3,5-dimethoxyphenyl)quinazolin-4-one.
| Compound Name | 3-(4-butan-2-ylphenyl)-2-(3,5-dimethoxyphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 24720134 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 3-(4-butan-2-ylphenyl)-2-(3,5-dimethoxyphenyl)quinazolin-4-one |
| SMILES | CCC(C)c1ccc(-n2c(-c3cc(OC)cc(OC)c3)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C26H26N2O3/c1-5-17(2)18-10-12-20(13-11-18)28-25(19-14-21(30-3)16-22(15-19)31-4)27-24-9-7-6-8-23(24)26(28)29/h6-17H,5H2,1-4H3 |
| InChIKey | RKMRPTVANRDSIF-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |