C26H23N3O — CID 46840315
3-(4-butan-2-ylphenyl)-2-(1H-indol-7-yl)quinazolin-4-one (PubChem CID 46840315) has the molecular formula C26H23N3O and a molecular weight of 393.49 g/mol. Its IUPAC name is 3-(4-butan-2-ylphenyl)-2-(1H-indol-7-yl)quinazolin-4-one.
| Compound Name | 3-(4-butan-2-ylphenyl)-2-(1H-indol-7-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 46840315 |
| Molecular Formula | C26H23N3O |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 3-(4-butan-2-ylphenyl)-2-(1H-indol-7-yl)quinazolin-4-one |
| SMILES | CCC(C)c1ccc(-n2c(-c3cccc4cc[nH]c34)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C26H23N3O/c1-3-17(2)18-11-13-20(14-12-18)29-25(22-9-6-7-19-15-16-27-24(19)22)28-23-10-5-4-8-21(23)26(29)30/h4-17,27H,3H2,1-2H3 |
| InChIKey | FIIGJZVHSNKSIU-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |