C26H22FN3O — CID 136785939
3-[4-[(2R)-butan-2-yl]phenyl]-2-(5-fluoro-1H-indol-3-yl)quinazolin-4-one (PubChem CID 136785939) has the molecular formula C26H22FN3O and a molecular weight of 411.48 g/mol. Its IUPAC name is 3-[4-[(2R)-butan-2-yl]phenyl]-2-(5-fluoro-1H-indol-3-yl)quinazolin-4-one.
| Compound Name | 3-[4-[(2R)-butan-2-yl]phenyl]-2-(5-fluoro-1H-indol-3-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 136785939 |
| Molecular Formula | C26H22FN3O |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 3-[4-[(2R)-butan-2-yl]phenyl]-2-(5-fluoro-1H-indol-3-yl)quinazolin-4-one |
| SMILES | CC[C@@H](C)c1ccc(-n2c(-c3c[nH]c4ccc(F)cc34)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C26H22FN3O/c1-3-16(2)17-8-11-19(12-9-17)30-25(29-24-7-5-4-6-20(24)26(30)31)22-15-28-23-13-10-18(27)14-21(22)23/h4-16,28H,3H2,1-2H3/t16-/m1/s1 |
| InChIKey | CAAVXIFUGLRPMS-MRXNPFEDSA-N |
| XLogP | 6.19 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |