C26H24F3N2O3S+ — CID 91399219
2-methyl-2-[2-methyl-4-[[2-[4-(trifluoromethyl)phenyl]indazol-2-ium-2-yl]methylsulfanyl]phenoxy]propanoic acid (PubChem CID 91399219) has the molecular formula C26H24F3N2O3S+ and a molecular weight of 501.55 g/mol. Its IUPAC name is 2-methyl-2-[2-methyl-4-[[2-[4-(trifluoromethyl)phenyl]indazol-2-ium-2-yl]methylsulfanyl]phenoxy]propanoic acid.
| Compound Name | 2-methyl-2-[2-methyl-4-[[2-[4-(trifluoromethyl)phenyl]indazol-2-ium-2-yl]methylsulfanyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 91399219 |
| Molecular Formula | C26H24F3N2O3S+ |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | 2-methyl-2-[2-methyl-4-[[2-[4-(trifluoromethyl)phenyl]indazol-2-ium-2-yl]methylsulfanyl]phenoxy]propanoic acid |
| SMILES | Cc1cc(SC[N+]2(c3ccc(C(F)(F)F)cc3)C=c3ccccc3=N2)ccc1OC(C)(C)C(=O)O |
| InChI | InChI=1S/C26H23F3N2O3S/c1-17-14-21(12-13-23(17)34-25(2,3)24(32)33)35-16-31(15-18-6-4-5-7-22(18)30-31)20-10-8-19(9-11-20)26(27,28)29/h4-15H,16H2,1-3H3/p+1 |
| InChIKey | SBHQPTVHXRGWFV-UHFFFAOYSA-O |
| XLogP | 5.30 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|