C24H28F3N3O3 — CID 143076110
2-[4-[4-[[amino-[4-(trifluoromethyl)phenyl]methylidene]amino]-4-methyliminobutyl]-2-methylphenoxy]-2-methylpropanoic acid (PubChem CID 143076110) has the molecular formula C24H28F3N3O3 and a molecular weight of 463.50 g/mol. Its IUPAC name is 2-[4-[4-[[amino-[4-(trifluoromethyl)phenyl]methylidene]amino]-4-methyliminobutyl]-2-methylphenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[4-[[amino-[4-(trifluoromethyl)phenyl]methylidene]amino]-4-methyliminobutyl]-2-methylphenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 143076110 |
| Molecular Formula | C24H28F3N3O3 |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 2-[4-[4-[[amino-[4-(trifluoromethyl)phenyl]methylidene]amino]-4-methyliminobutyl]-2-methylphenoxy]-2-methylpropanoic acid |
| SMILES | C/N=C(CCCc1ccc(OC(C)(C)C(=O)O)c(C)c1)/N=C(\N)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H28F3N3O3/c1-15-14-16(8-13-19(15)33-23(2,3)22(31)32)6-5-7-20(29-4)30-21(28)17-9-11-18(12-10-17)24(25,26)27/h8-14H,5-7H2,1-4H3,(H,31,32)(H2,28,29,30) |
| InChIKey | FXGWZQGNLFXKDL-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|