C22H24F3N3O4 — CID 143076009
2-[4-[[2-[[amino-[4-(trifluoromethyl)phenyl]methylidene]amino]-2-methyliminoethoxy]methyl]phenoxy]-2-methylpropanoic acid (PubChem CID 143076009) has the molecular formula C22H24F3N3O4 and a molecular weight of 451.45 g/mol. Its IUPAC name is 2-[4-[[2-[[amino-[4-(trifluoromethyl)phenyl]methylidene]amino]-2-methyliminoethoxy]methyl]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[[2-[[amino-[4-(trifluoromethyl)phenyl]methylidene]amino]-2-methyliminoethoxy]methyl]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 143076009 |
| Molecular Formula | C22H24F3N3O4 |
| Molecular Weight | 451.45 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 2-[4-[[2-[[amino-[4-(trifluoromethyl)phenyl]methylidene]amino]-2-methyliminoethoxy]methyl]phenoxy]-2-methylpropanoic acid |
| SMILES | C/N=C(COCc1ccc(OC(C)(C)C(=O)O)cc1)/N=C(\N)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H24F3N3O4/c1-21(2,20(29)30)32-17-10-4-14(5-11-17)12-31-13-18(27-3)28-19(26)15-6-8-16(9-7-15)22(23,24)25/h4-11H,12-13H2,1-3H3,(H,29,30)(H2,26,27,28) |
| InChIKey | ODIHZSUEMFTXEN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|