C13H28N- — CID 91399919
7-ethyl-N,8-dimethylnonan-2-amine (PubChem CID 91399919) has the molecular formula C13H28N- and a molecular weight of 198.37 g/mol. Its IUPAC name is 7-ethyl-N,8-dimethylnonan-2-amine.
| Compound Name | 7-ethyl-N,8-dimethylnonan-2-amine |
|---|---|
| PubChem CID | 91399919 |
| Molecular Formula | C13H28N- |
| Molecular Weight | 198.37 g/mol |
| Exact Mass | 198.22 |
| IUPAC Name | 7-ethyl-N,8-dimethylnonan-2-amine |
| SMILES | [CH2-]C(CCCCC(CC)C(C)C)NC |
| InChI | InChI=1S/C13H28N/c1-6-13(11(2)3)10-8-7-9-12(4)14-5/h11-14H,4,6-10H2,1-3,5H3/q-1 |
| InChIKey | MJTJTUXCQSCDJE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|