About 7-ethyl-N,2-dimethylundecan-6-amine
7-ethyl-N,2-dimethylundecan-6-amine (PubChem CID 105028702) has the molecular formula C15H33N
and a molecular weight of 227.44 g/mol. Its IUPAC name is 7-ethyl-N,2-dimethylundecan-6-amine.
Molecular Properties
| Compound Name | 7-ethyl-N,2-dimethylundecan-6-amine |
| PubChem CID | 105028702 |
| Molecular Formula | C15H33N |
| Molecular Weight | 227.44 g/mol |
| Exact Mass | 227.26 |
| IUPAC Name | 7-ethyl-N,2-dimethylundecan-6-amine |
| SMILES | CCCCC(CC)C(CCCC(C)C)NC |
| InChI | InChI=1S/C15H33N/c1-6-8-11-14(7-2)15(16-5)12-9-10-13(3)4/h13-16H,6-12H2,1-5H3 |
| InChIKey | BOJNLKCZLFZVGH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.44 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-ethyl-N,2-dimethylundecan-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-N,2-dimethylundecan-6-amine?
The IUPAC name of 7-ethyl-N,2-dimethylundecan-6-amine (CID 105028702) is 7-ethyl-N,2-dimethylundecan-6-amine.
What is the SMILES notation for 7-ethyl-N,2-dimethylundecan-6-amine?
The canonical SMILES for 7-ethyl-N,2-dimethylundecan-6-amine is CCCCC(CC)C(CCCC(C)C)NC.
What is the InChIKey of 7-ethyl-N,2-dimethylundecan-6-amine?
The InChIKey is BOJNLKCZLFZVGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H33N/c1-6-8-11-14(7-2)15(16-5)12-9-10-13(3)4/h13-16H,6-12H2,1-5H3.
What are the key properties of 7-ethyl-N,2-dimethylundecan-6-amine?
7-ethyl-N,2-dimethylundecan-6-amine has a molecular weight of 227.44 g/mol, XLogP of 4.62, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-N,2-dimethylundecan-6-amine is sourced from PubChem (CID 105028702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).