C16H11ClN4OS — CID 91401540
3-(3H-benzimidazol-5-yl)-4-(4-chlorophenyl)-5-sulfanyl-1H-imidazol-2-one (PubChem CID 91401540) has the molecular formula C16H11ClN4OS and a molecular weight of 342.81 g/mol. Its IUPAC name is 3-(3H-benzimidazol-5-yl)-4-(4-chlorophenyl)-5-sulfanyl-1H-imidazol-2-one.
| Compound Name | 3-(3H-benzimidazol-5-yl)-4-(4-chlorophenyl)-5-sulfanyl-1H-imidazol-2-one |
|---|---|
| PubChem CID | 91401540 |
| Molecular Formula | C16H11ClN4OS |
| Molecular Weight | 342.81 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 3-(3H-benzimidazol-5-yl)-4-(4-chlorophenyl)-5-sulfanyl-1H-imidazol-2-one |
| SMILES | O=c1[nH]c(S)c(-c2ccc(Cl)cc2)n1-c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C16H11ClN4OS/c17-10-3-1-9(2-4-10)14-15(23)20-16(22)21(14)11-5-6-12-13(7-11)19-8-18-12/h1-8,23H,(H,18,19)(H,20,22) |
| InChIKey | SXDDSNVJRMCODF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 66.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.81 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|