C18H12ClF2N3O2 — CID 90992204
1-(3H-benzimidazol-5-yl)-5-(2-chloro-3,6-difluorophenyl)-4-methylpyrrole-2,3-diol (PubChem CID 90992204) has the molecular formula C18H12ClF2N3O2 and a molecular weight of 375.76 g/mol. Its IUPAC name is 1-(3H-benzimidazol-5-yl)-5-(2-chloro-3,6-difluorophenyl)-4-methylpyrrole-2,3-diol.
| Compound Name | 1-(3H-benzimidazol-5-yl)-5-(2-chloro-3,6-difluorophenyl)-4-methylpyrrole-2,3-diol |
|---|---|
| PubChem CID | 90992204 |
| Molecular Formula | C18H12ClF2N3O2 |
| Molecular Weight | 375.76 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 1-(3H-benzimidazol-5-yl)-5-(2-chloro-3,6-difluorophenyl)-4-methylpyrrole-2,3-diol |
| SMILES | Cc1c(O)c(O)n(-c2ccc3nc[nH]c3c2)c1-c1c(F)ccc(F)c1Cl |
| InChI | InChI=1S/C18H12ClF2N3O2/c1-8-16(14-10(20)3-4-11(21)15(14)19)24(18(26)17(8)25)9-2-5-12-13(6-9)23-7-22-12/h2-7,25-26H,1H3,(H,22,23) |
| InChIKey | AACDUZSXGGQIRZ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.76 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|