C19H13F4N3O2 — CID 91144999
1-(3H-benzimidazol-5-yl)-4-ethyl-5-(2,3,5,6-tetrafluorophenyl)pyrrole-2,3-diol (PubChem CID 91144999) has the molecular formula C19H13F4N3O2 and a molecular weight of 391.32 g/mol. Its IUPAC name is 1-(3H-benzimidazol-5-yl)-4-ethyl-5-(2,3,5,6-tetrafluorophenyl)pyrrole-2,3-diol.
| Compound Name | 1-(3H-benzimidazol-5-yl)-4-ethyl-5-(2,3,5,6-tetrafluorophenyl)pyrrole-2,3-diol |
|---|---|
| PubChem CID | 91144999 |
| Molecular Formula | C19H13F4N3O2 |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 1-(3H-benzimidazol-5-yl)-4-ethyl-5-(2,3,5,6-tetrafluorophenyl)pyrrole-2,3-diol |
| SMILES | CCc1c(O)c(O)n(-c2ccc3nc[nH]c3c2)c1-c1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C19H13F4N3O2/c1-2-9-17(14-15(22)10(20)6-11(21)16(14)23)26(19(28)18(9)27)8-3-4-12-13(5-8)25-7-24-12/h3-7,27-28H,2H2,1H3,(H,24,25) |
| InChIKey | PLGJSBQIXSQGDG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|