C15H29NOSi — CID 91402301
ethane;1-[5-[ethyl(dimethyl)silyl]-2,4-dimethyl-2H-pyridin-1-yl]ethanone (PubChem CID 91402301) has the molecular formula C15H29NOSi and a molecular weight of 267.49 g/mol. Its IUPAC name is ethane;1-[5-[ethyl(dimethyl)silyl]-2,4-dimethyl-2H-pyridin-1-yl]ethanone.
| Compound Name | ethane;1-[5-[ethyl(dimethyl)silyl]-2,4-dimethyl-2H-pyridin-1-yl]ethanone |
|---|---|
| PubChem CID | 91402301 |
| Molecular Formula | C15H29NOSi |
| Molecular Weight | 267.49 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | ethane;1-[5-[ethyl(dimethyl)silyl]-2,4-dimethyl-2H-pyridin-1-yl]ethanone |
| SMILES | CC.CC[Si](C)(C)C1=CN(C(C)=O)C(C)C=C1C |
| InChI | InChI=1S/C13H23NOSi.C2H6/c1-7-16(5,6)13-9-14(12(4)15)11(3)8-10(13)2;1-2/h8-9,11H,7H2,1-6H3;1-2H3 |
| InChIKey | SWBWZGVCQBZMHK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|