C26H38O6 — CID 91402356
(10R,11R,13S,17R)-11-(2-methoxyethoxymethoxy)-10,13-dimethylspiro[2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione (PubChem CID 91402356) has the molecular formula C26H38O6 and a molecular weight of 446.58 g/mol. Its IUPAC name is (10R,11R,13S,17R)-11-(2-methoxyethoxymethoxy)-10,13-dimethylspiro[2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione.
| Compound Name | (10R,11R,13S,17R)-11-(2-methoxyethoxymethoxy)-10,13-dimethylspiro[2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione |
|---|---|
| PubChem CID | 91402356 |
| Molecular Formula | C26H38O6 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | (10R,11R,13S,17R)-11-(2-methoxyethoxymethoxy)-10,13-dimethylspiro[2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione |
| SMILES | COCCOCOC1C[C@@]2(C)C(CC[C@@]23CCC(=O)O3)C2CC=C3CC(=O)CC[C@]3(C)C12 |
| InChI | InChI=1S/C26H38O6/c1-24-9-6-18(27)14-17(24)4-5-19-20-7-10-26(11-8-22(28)32-26)25(20,2)15-21(23(19)24)31-16-30-13-12-29-3/h4,19-21,23H,5-16H2,1-3H3/t19?,20?,21?,23?,24-,25-,26+/m0/s1 |
| InChIKey | WRDGBRTUEUAVNX-PCRNETOXSA-N |
| XLogP | 4.21 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|