C24H34O3 — CID 632806
1-ethoxy-10,13-dimethylspiro[3,4,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,5'-oxolane]-2'-one (PubChem CID 632806) has the molecular formula C24H34O3 and a molecular weight of 370.53 g/mol. Its IUPAC name is 1-ethoxy-10,13-dimethylspiro[3,4,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,5'-oxolane]-2'-one.
| Compound Name | 1-ethoxy-10,13-dimethylspiro[3,4,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,5'-oxolane]-2'-one |
|---|---|
| PubChem CID | 632806 |
| Molecular Formula | C24H34O3 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 1-ethoxy-10,13-dimethylspiro[3,4,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,5'-oxolane]-2'-one |
| SMILES | CCOC1=CCCC2=CCC3C(CCC4(C)C3CCC43CCC(=O)O3)C21C |
| InChI | InChI=1S/C24H34O3/c1-4-26-20-7-5-6-16-8-9-17-18-11-14-24(15-12-21(25)27-24)22(18,2)13-10-19(17)23(16,20)3/h7-8,17-19H,4-6,9-15H2,1-3H3 |
| InChIKey | MYJAIBCFOWBIBW-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|