C21H25F3N2O2 — CID 91402853
N-[[2-methoxy-5-(trifluoromethoxy)phenyl]methyl]-1-methyl-2-phenylpiperidin-3-amine (PubChem CID 91402853) has the molecular formula C21H25F3N2O2 and a molecular weight of 394.44 g/mol. Its IUPAC name is N-[[2-methoxy-5-(trifluoromethoxy)phenyl]methyl]-1-methyl-2-phenylpiperidin-3-amine.
| Compound Name | N-[[2-methoxy-5-(trifluoromethoxy)phenyl]methyl]-1-methyl-2-phenylpiperidin-3-amine |
|---|---|
| PubChem CID | 91402853 |
| Molecular Formula | C21H25F3N2O2 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | N-[[2-methoxy-5-(trifluoromethoxy)phenyl]methyl]-1-methyl-2-phenylpiperidin-3-amine |
| SMILES | COc1ccc(OC(F)(F)F)cc1CNC1CCCN(C)C1c1ccccc1 |
| InChI | InChI=1S/C21H25F3N2O2/c1-26-12-6-9-18(20(26)15-7-4-3-5-8-15)25-14-16-13-17(28-21(22,23)24)10-11-19(16)27-2/h3-5,7-8,10-11,13,18,20,25H,6,9,12,14H2,1-2H3 |
| InChIKey | ANMUQUBRHXAGEY-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |