C23H21ClN2O3 — CID 91402944
[3-(chloromethyl)benzoyl] 1,1-dimethyl-5,6-dihydro-2H-azepino[4,5-b]indole-5-carboxylate (PubChem CID 91402944) has the molecular formula C23H21ClN2O3 and a molecular weight of 408.89 g/mol. Its IUPAC name is [3-(chloromethyl)benzoyl] 1,1-dimethyl-5,6-dihydro-2H-azepino[4,5-b]indole-5-carboxylate.
| Compound Name | [3-(chloromethyl)benzoyl] 1,1-dimethyl-5,6-dihydro-2H-azepino[4,5-b]indole-5-carboxylate |
|---|---|
| PubChem CID | 91402944 |
| Molecular Formula | C23H21ClN2O3 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | [3-(chloromethyl)benzoyl] 1,1-dimethyl-5,6-dihydro-2H-azepino[4,5-b]indole-5-carboxylate |
| SMILES | CC1(C)CN=CC(C(=O)OC(=O)c2cccc(CCl)c2)c2[nH]c3ccccc3c21 |
| InChI | InChI=1S/C23H21ClN2O3/c1-23(2)13-25-12-17(20-19(23)16-8-3-4-9-18(16)26-20)22(28)29-21(27)15-7-5-6-14(10-15)11-24/h3-10,12,17,26H,11,13H2,1-2H3 |
| InChIKey | MXIVNIQLVUSTSG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 71.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|