C14H15BrCl2N2O — CID 91404172
3-bromo-8-[(3,4-dichlorophenyl)methyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-ene (PubChem CID 91404172) has the molecular formula C14H15BrCl2N2O and a molecular weight of 378.10 g/mol. Its IUPAC name is 3-bromo-8-[(3,4-dichlorophenyl)methyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-ene.
| Compound Name | 3-bromo-8-[(3,4-dichlorophenyl)methyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-ene |
|---|---|
| PubChem CID | 91404172 |
| Molecular Formula | C14H15BrCl2N2O |
| Molecular Weight | 378.10 g/mol |
| Exact Mass | 375.97 |
| IUPAC Name | 3-bromo-8-[(3,4-dichlorophenyl)methyl]-1-oxa-2,8-diazaspiro[4.5]dec-3-ene |
| SMILES | Clc1ccc(CN2CCC3(C=C(Br)NO3)CC2)cc1Cl |
| InChI | InChI=1S/C14H15BrCl2N2O/c15-13-8-14(20-18-13)3-5-19(6-4-14)9-10-1-2-11(16)12(17)7-10/h1-2,7-8,18H,3-6,9H2 |
| InChIKey | WUBYLSDDGVKUNK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.10 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|