About 4-(2-bromoethoxy)-1-[(3,4-dichlorophenyl)methyl]piperidine
4-(2-bromoethoxy)-1-[(3,4-dichlorophenyl)methyl]piperidine (PubChem CID 82690798) has the molecular formula C14H18BrCl2NO
and a molecular weight of 367.11 g/mol. Its IUPAC name is 4-(2-bromoethoxy)-1-[(3,4-dichlorophenyl)methyl]piperidine.
Molecular Properties
| Compound Name | 4-(2-bromoethoxy)-1-[(3,4-dichlorophenyl)methyl]piperidine |
| PubChem CID | 82690798 |
| Molecular Formula | C14H18BrCl2NO |
| Molecular Weight | 367.11 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | 4-(2-bromoethoxy)-1-[(3,4-dichlorophenyl)methyl]piperidine |
| SMILES | Clc1ccc(CN2CCC(OCCBr)CC2)cc1Cl |
| InChI | InChI=1S/C14H18BrCl2NO/c15-5-8-19-12-3-6-18(7-4-12)10-11-1-2-13(16)14(17)9-11/h1-2,9,12H,3-8,10H2 |
| InChIKey | WCKTVDDCMFGJRL-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.11 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-bromoethoxy)-1-[(3,4-dichlorophenyl)methyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-bromoethoxy)-1-[(3,4-dichlorophenyl)methyl]piperidine?
The IUPAC name of 4-(2-bromoethoxy)-1-[(3,4-dichlorophenyl)methyl]piperidine (CID 82690798) is 4-(2-bromoethoxy)-1-[(3,4-dichlorophenyl)methyl]piperidine.
What is the SMILES notation for 4-(2-bromoethoxy)-1-[(3,4-dichlorophenyl)methyl]piperidine?
The canonical SMILES for 4-(2-bromoethoxy)-1-[(3,4-dichlorophenyl)methyl]piperidine is Clc1ccc(CN2CCC(OCCBr)CC2)cc1Cl.
What is the InChIKey of 4-(2-bromoethoxy)-1-[(3,4-dichlorophenyl)methyl]piperidine?
The InChIKey is WCKTVDDCMFGJRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18BrCl2NO/c15-5-8-19-12-3-6-18(7-4-12)10-11-1-2-13(16)14(17)9-11/h1-2,9,12H,3-8,10H2.
What are the key properties of 4-(2-bromoethoxy)-1-[(3,4-dichlorophenyl)methyl]piperidine?
4-(2-bromoethoxy)-1-[(3,4-dichlorophenyl)methyl]piperidine has a molecular weight of 367.11 g/mol, XLogP of 4.37, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-bromoethoxy)-1-[(3,4-dichlorophenyl)methyl]piperidine is sourced from PubChem (CID 82690798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).