C17H30O2 — CID 91406670
5,11-dimethyl-8-propan-2-yldodeca-7,10-dienoic acid (PubChem CID 91406670) has the molecular formula C17H30O2 and a molecular weight of 266.42 g/mol. Its IUPAC name is 5,11-dimethyl-8-propan-2-yldodeca-7,10-dienoic acid.
| Compound Name | 5,11-dimethyl-8-propan-2-yldodeca-7,10-dienoic acid |
|---|---|
| PubChem CID | 91406670 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 5,11-dimethyl-8-propan-2-yldodeca-7,10-dienoic acid |
| SMILES | CC(C)=CCC(=CCC(C)CCCC(=O)O)C(C)C |
| InChI | InChI=1S/C17H30O2/c1-13(2)9-11-16(14(3)4)12-10-15(5)7-6-8-17(18)19/h9,12,14-15H,6-8,10-11H2,1-5H3,(H,18,19) |
| InChIKey | WBLZAABGIQUTNJ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|