C22H31N3O3S — CID 91407227
4-[(3-morpholin-4-ylpropylamino)methyl]-N-(2-phenylethyl)benzenesulfonamide (PubChem CID 91407227) has the molecular formula C22H31N3O3S and a molecular weight of 417.58 g/mol. Its IUPAC name is 4-[(3-morpholin-4-ylpropylamino)methyl]-N-(2-phenylethyl)benzenesulfonamide.
| Compound Name | 4-[(3-morpholin-4-ylpropylamino)methyl]-N-(2-phenylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 91407227 |
| Molecular Formula | C22H31N3O3S |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 4-[(3-morpholin-4-ylpropylamino)methyl]-N-(2-phenylethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCCc1ccccc1)c1ccc(CNCCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C22H31N3O3S/c26-29(27,24-13-11-20-5-2-1-3-6-20)22-9-7-21(8-10-22)19-23-12-4-14-25-15-17-28-18-16-25/h1-3,5-10,23-24H,4,11-19H2 |
| InChIKey | GJEMERQHIPRXTM-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|