C22H26N4O5S2 — CID 91407835
N-[1-oxo-1-[6-oxo-4-(pyridin-2-ylmethylsulfonyl)-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]pentan-2-yl]thiophene-3-carboxamide (PubChem CID 91407835) has the molecular formula C22H26N4O5S2 and a molecular weight of 490.61 g/mol. Its IUPAC name is N-[1-oxo-1-[6-oxo-4-(pyridin-2-ylmethylsulfonyl)-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]pentan-2-yl]thiophene-3-carboxamide.
| Compound Name | N-[1-oxo-1-[6-oxo-4-(pyridin-2-ylmethylsulfonyl)-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]pentan-2-yl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 91407835 |
| Molecular Formula | C22H26N4O5S2 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | N-[1-oxo-1-[6-oxo-4-(pyridin-2-ylmethylsulfonyl)-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]pentan-2-yl]thiophene-3-carboxamide |
| SMILES | CCCC(NC(=O)c1ccsc1)C(=O)N1CCC2C1C(=O)CN2S(=O)(=O)Cc1ccccn1 |
| InChI | InChI=1S/C22H26N4O5S2/c1-2-5-17(24-21(28)15-8-11-32-13-15)22(29)25-10-7-18-20(25)19(27)12-26(18)33(30,31)14-16-6-3-4-9-23-16/h3-4,6,8-9,11,13,17-18,20H,2,5,7,10,12,14H2,1H3,(H,24,28) |
| InChIKey | ONUVSLHLDGMFNW-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |