C22H24N4O6S2 — CID 90937494
N-[1-oxo-1-[6-oxo-4-(pyridine-3-carbonylsulfonyl)-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]pentan-2-yl]thiophene-3-carboxamide (PubChem CID 90937494) has the molecular formula C22H24N4O6S2 and a molecular weight of 504.59 g/mol. Its IUPAC name is N-[1-oxo-1-[6-oxo-4-(pyridine-3-carbonylsulfonyl)-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]pentan-2-yl]thiophene-3-carboxamide.
| Compound Name | N-[1-oxo-1-[6-oxo-4-(pyridine-3-carbonylsulfonyl)-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]pentan-2-yl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 90937494 |
| Molecular Formula | C22H24N4O6S2 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | N-[1-oxo-1-[6-oxo-4-(pyridine-3-carbonylsulfonyl)-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]pentan-2-yl]thiophene-3-carboxamide |
| SMILES | CCCC(NC(=O)c1ccsc1)C(=O)N1CCC2C1C(=O)CN2S(=O)(=O)C(=O)c1cccnc1 |
| InChI | InChI=1S/C22H24N4O6S2/c1-2-4-16(24-20(28)15-7-10-33-13-15)21(29)25-9-6-17-19(25)18(27)12-26(17)34(31,32)22(30)14-5-3-8-23-11-14/h3,5,7-8,10-11,13,16-17,19H,2,4,6,9,12H2,1H3,(H,24,28) |
| InChIKey | QAUJSQQQICIZEU-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 133.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|