C24H28N4O7S — CID 91221118
N-[4,4-dimethyl-1-oxo-1-[6-oxo-4-(pyridine-3-carbonylsulfonyl)-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]pentan-2-yl]furan-3-carboxamide (PubChem CID 91221118) has the molecular formula C24H28N4O7S and a molecular weight of 516.58 g/mol. Its IUPAC name is N-[4,4-dimethyl-1-oxo-1-[6-oxo-4-(pyridine-3-carbonylsulfonyl)-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]pentan-2-yl]furan-3-carboxamide.
| Compound Name | N-[4,4-dimethyl-1-oxo-1-[6-oxo-4-(pyridine-3-carbonylsulfonyl)-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]pentan-2-yl]furan-3-carboxamide |
|---|---|
| PubChem CID | 91221118 |
| Molecular Formula | C24H28N4O7S |
| Molecular Weight | 516.58 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | N-[4,4-dimethyl-1-oxo-1-[6-oxo-4-(pyridine-3-carbonylsulfonyl)-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]pentan-2-yl]furan-3-carboxamide |
| SMILES | CC(C)(C)CC(NC(=O)c1ccoc1)C(=O)N1CCC2C1C(=O)CN2S(=O)(=O)C(=O)c1cccnc1 |
| InChI | InChI=1S/C24H28N4O7S/c1-24(2,3)11-17(26-21(30)16-7-10-35-14-16)22(31)27-9-6-18-20(27)19(29)13-28(18)36(33,34)23(32)15-5-4-8-25-12-15/h4-5,7-8,10,12,14,17-18,20H,6,9,11,13H2,1-3H3,(H,26,30) |
| InChIKey | MQMUOPAUQJFQLN-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 146.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.58 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|