C26H26N4O6S2 — CID 91308714
N-[1-oxo-1-[6-oxo-4-(pyridine-3-carbonylsulfonyl)-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]pentan-2-yl]-1-benzothiophene-2-carboxamide (PubChem CID 91308714) has the molecular formula C26H26N4O6S2 and a molecular weight of 554.65 g/mol. Its IUPAC name is N-[1-oxo-1-[6-oxo-4-(pyridine-3-carbonylsulfonyl)-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]pentan-2-yl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-[1-oxo-1-[6-oxo-4-(pyridine-3-carbonylsulfonyl)-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]pentan-2-yl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 91308714 |
| Molecular Formula | C26H26N4O6S2 |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.13 |
| IUPAC Name | N-[1-oxo-1-[6-oxo-4-(pyridine-3-carbonylsulfonyl)-3,3a,5,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]pentan-2-yl]-1-benzothiophene-2-carboxamide |
| SMILES | CCCC(NC(=O)c1cc2ccccc2s1)C(=O)N1CCC2C1C(=O)CN2S(=O)(=O)C(=O)c1cccnc1 |
| InChI | InChI=1S/C26H26N4O6S2/c1-2-6-18(28-24(32)22-13-16-7-3-4-9-21(16)37-22)25(33)29-12-10-19-23(29)20(31)15-30(19)38(35,36)26(34)17-8-5-11-27-14-17/h3-5,7-9,11,13-14,18-19,23H,2,6,10,12,15H2,1H3,(H,28,32) |
| InChIKey | QDLWMORNBGNQTA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 133.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|