C15H20FNO2S2 — CID 91409933
5-fluoro-3-methyl-N,N-dipropyl-1-benzothiophene-2-sulfonamide (PubChem CID 91409933) has the molecular formula C15H20FNO2S2 and a molecular weight of 329.46 g/mol. Its IUPAC name is 5-fluoro-3-methyl-N,N-dipropyl-1-benzothiophene-2-sulfonamide.
| Compound Name | 5-fluoro-3-methyl-N,N-dipropyl-1-benzothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 91409933 |
| Molecular Formula | C15H20FNO2S2 |
| Molecular Weight | 329.46 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 5-fluoro-3-methyl-N,N-dipropyl-1-benzothiophene-2-sulfonamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1sc2ccc(F)cc2c1C |
| InChI | InChI=1S/C15H20FNO2S2/c1-4-8-17(9-5-2)21(18,19)15-11(3)13-10-12(16)6-7-14(13)20-15/h6-7,10H,4-5,8-9H2,1-3H3 |
| InChIKey | FJVMDACEMPMFJC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |