C28H27N3OS — CID 91410552
N-(2-aminophenyl)-4-[1-(4-cyclohepta-1,3,6-trien-1-yl-1,3-thiazol-2-yl)cyclopentyl]benzamide (PubChem CID 91410552) has the molecular formula C28H27N3OS and a molecular weight of 453.61 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[1-(4-cyclohepta-1,3,6-trien-1-yl-1,3-thiazol-2-yl)cyclopentyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[1-(4-cyclohepta-1,3,6-trien-1-yl-1,3-thiazol-2-yl)cyclopentyl]benzamide |
|---|---|
| PubChem CID | 91410552 |
| Molecular Formula | C28H27N3OS |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | N-(2-aminophenyl)-4-[1-(4-cyclohepta-1,3,6-trien-1-yl-1,3-thiazol-2-yl)cyclopentyl]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(C2(c3nc(C4=CC=CCC=C4)cs3)CCCC2)cc1 |
| InChI | InChI=1S/C28H27N3OS/c29-23-11-5-6-12-24(23)30-26(32)21-13-15-22(16-14-21)28(17-7-8-18-28)27-31-25(19-33-27)20-9-3-1-2-4-10-20/h1,3-6,9-16,19H,2,7-8,17-18,29H2,(H,30,32) |
| InChIKey | HRMUTXOCLBZICO-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|