C26H28N4O4S — CID 87514351
N-hydroxy-4-[1-[4-[6-(2-methoxyethoxy)-2-methylimidazo[1,2-a]pyridin-3-yl]-1,3-thiazol-2-yl]cyclopentyl]benzamide (PubChem CID 87514351) has the molecular formula C26H28N4O4S and a molecular weight of 492.60 g/mol. Its IUPAC name is N-hydroxy-4-[1-[4-[6-(2-methoxyethoxy)-2-methylimidazo[1,2-a]pyridin-3-yl]-1,3-thiazol-2-yl]cyclopentyl]benzamide.
| Compound Name | N-hydroxy-4-[1-[4-[6-(2-methoxyethoxy)-2-methylimidazo[1,2-a]pyridin-3-yl]-1,3-thiazol-2-yl]cyclopentyl]benzamide |
|---|---|
| PubChem CID | 87514351 |
| Molecular Formula | C26H28N4O4S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | N-hydroxy-4-[1-[4-[6-(2-methoxyethoxy)-2-methylimidazo[1,2-a]pyridin-3-yl]-1,3-thiazol-2-yl]cyclopentyl]benzamide |
| SMILES | COCCOc1ccc2nc(C)c(-c3csc(C4(c5ccc(C(=O)NO)cc5)CCCC4)n3)n2c1 |
| InChI | InChI=1S/C26H28N4O4S/c1-17-23(30-15-20(34-14-13-33-2)9-10-22(30)27-17)21-16-35-25(28-21)26(11-3-4-12-26)19-7-5-18(6-8-19)24(31)29-32/h5-10,15-16,32H,3-4,11-14H2,1-2H3,(H,29,31) |
| InChIKey | DPFPWAHIXPGIPL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|