C23H20N4O4S — CID 87514257
methyl 3-[2-[1-[4-(hydroxycarbamoyl)phenyl]cyclopropyl]-1,3-thiazol-4-yl]-2-methylimidazo[1,2-a]pyridine-7-carboxylate (PubChem CID 87514257) has the molecular formula C23H20N4O4S and a molecular weight of 448.50 g/mol. Its IUPAC name is methyl 3-[2-[1-[4-(hydroxycarbamoyl)phenyl]cyclopropyl]-1,3-thiazol-4-yl]-2-methylimidazo[1,2-a]pyridine-7-carboxylate.
| Compound Name | methyl 3-[2-[1-[4-(hydroxycarbamoyl)phenyl]cyclopropyl]-1,3-thiazol-4-yl]-2-methylimidazo[1,2-a]pyridine-7-carboxylate |
|---|---|
| PubChem CID | 87514257 |
| Molecular Formula | C23H20N4O4S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | methyl 3-[2-[1-[4-(hydroxycarbamoyl)phenyl]cyclopropyl]-1,3-thiazol-4-yl]-2-methylimidazo[1,2-a]pyridine-7-carboxylate |
| SMILES | COC(=O)c1ccn2c(-c3csc(C4(c5ccc(C(=O)NO)cc5)CC4)n3)c(C)nc2c1 |
| InChI | InChI=1S/C23H20N4O4S/c1-13-19(27-10-7-15(21(29)31-2)11-18(27)24-13)17-12-32-22(25-17)23(8-9-23)16-5-3-14(4-6-16)20(28)26-30/h3-7,10-12,30H,8-9H2,1-2H3,(H,26,28) |
| InChIKey | SXMAXJLXTGXLJY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|