C24H24N4O3S — CID 44623557
N-hydroxy-4-[4-[5-methyl-4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]oxan-4-yl]benzamide (PubChem CID 44623557) has the molecular formula C24H24N4O3S and a molecular weight of 448.55 g/mol. Its IUPAC name is N-hydroxy-4-[4-[5-methyl-4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]oxan-4-yl]benzamide.
| Compound Name | N-hydroxy-4-[4-[5-methyl-4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]oxan-4-yl]benzamide |
|---|---|
| PubChem CID | 44623557 |
| Molecular Formula | C24H24N4O3S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | N-hydroxy-4-[4-[5-methyl-4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]oxan-4-yl]benzamide |
| SMILES | Cc1nc2ccccn2c1-c1nc(C2(c3ccc(C(=O)NO)cc3)CCOCC2)sc1C |
| InChI | InChI=1S/C24H24N4O3S/c1-15-21(28-12-4-3-5-19(28)25-15)20-16(2)32-23(26-20)24(10-13-31-14-11-24)18-8-6-17(7-9-18)22(29)27-30/h3-9,12,30H,10-11,13-14H2,1-2H3,(H,27,29) |
| InChIKey | GNLNSHMQCFOINL-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|