C34H50N4O8 — CID 91411092
4-O-benzyl 6-O-methyl 1-[2-cyclohexyl-2-[[2-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-oxopropyl]amino]acetyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4,6-dicarboxylate (PubChem CID 91411092) has the molecular formula C34H50N4O8 and a molecular weight of 642.79 g/mol. Its IUPAC name is 4-O-benzyl 6-O-methyl 1-[2-cyclohexyl-2-[[2-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-oxopropyl]amino]acetyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4,6-dicarboxylate.
| Compound Name | 4-O-benzyl 6-O-methyl 1-[2-cyclohexyl-2-[[2-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-oxopropyl]amino]acetyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4,6-dicarboxylate |
|---|---|
| PubChem CID | 91411092 |
| Molecular Formula | C34H50N4O8 |
| Molecular Weight | 642.79 g/mol |
| Exact Mass | 642.36 |
| IUPAC Name | 4-O-benzyl 6-O-methyl 1-[2-cyclohexyl-2-[[2-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-oxopropyl]amino]acetyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4,6-dicarboxylate |
| SMILES | COC(=O)C1CN(C(=O)OCc2ccccc2)C2CCN(C(=O)C(NCC(C)(C=O)N(C)C(=O)OC(C)(C)C)C3CCCCC3)C12 |
| InChI | InChI=1S/C34H50N4O8/c1-33(2,3)46-31(42)36(5)34(4,22-39)21-35-27(24-15-11-8-12-16-24)29(40)37-18-17-26-28(37)25(30(41)44-6)19-38(26)32(43)45-20-23-13-9-7-10-14-23/h7,9-10,13-14,22,24-28,35H,8,11-12,15-21H2,1-6H3 |
| InChIKey | VYSCZGWOSKQIMC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 134.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.79 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|