C24H31N3O7S — CID 91411148
2-hydroxy-6-[7-[4-hydroxy-3-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)phenyl]heptoxy]-N,N-dimethylbenzamide (PubChem CID 91411148) has the molecular formula C24H31N3O7S and a molecular weight of 505.59 g/mol. Its IUPAC name is 2-hydroxy-6-[7-[4-hydroxy-3-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)phenyl]heptoxy]-N,N-dimethylbenzamide.
| Compound Name | 2-hydroxy-6-[7-[4-hydroxy-3-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)phenyl]heptoxy]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 91411148 |
| Molecular Formula | C24H31N3O7S |
| Molecular Weight | 505.59 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | 2-hydroxy-6-[7-[4-hydroxy-3-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)phenyl]heptoxy]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1c(O)cccc1OCCCCCCCc1ccc(O)c(N2C=C(O)NS2(=O)=O)c1 |
| InChI | InChI=1S/C24H31N3O7S/c1-26(2)24(31)23-20(29)10-8-11-21(23)34-14-7-5-3-4-6-9-17-12-13-19(28)18(15-17)27-16-22(30)25-35(27,32)33/h8,10-13,15-16,25,28-30H,3-7,9,14H2,1-2H3 |
| InChIKey | LVVDAZFNZHGRJG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 139.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.59 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|