C21H25N3O7S — CID 91598053
3-[3-hydroxy-4-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)phenyl]-N-[4-(2-hydroxyphenoxy)butyl]propanamide (PubChem CID 91598053) has the molecular formula C21H25N3O7S and a molecular weight of 463.51 g/mol. Its IUPAC name is 3-[3-hydroxy-4-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)phenyl]-N-[4-(2-hydroxyphenoxy)butyl]propanamide.
| Compound Name | 3-[3-hydroxy-4-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)phenyl]-N-[4-(2-hydroxyphenoxy)butyl]propanamide |
|---|---|
| PubChem CID | 91598053 |
| Molecular Formula | C21H25N3O7S |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | 3-[3-hydroxy-4-(3-hydroxy-1,1-dioxo-2H-1,2,5-thiadiazol-5-yl)phenyl]-N-[4-(2-hydroxyphenoxy)butyl]propanamide |
| SMILES | O=C(CCc1ccc(N2C=C(O)NS2(=O)=O)c(O)c1)NCCCCOc1ccccc1O |
| InChI | InChI=1S/C21H25N3O7S/c25-17-5-1-2-6-19(17)31-12-4-3-11-22-20(27)10-8-15-7-9-16(18(26)13-15)24-14-21(28)23-32(24,29)30/h1-2,5-7,9,13-14,23,25-26,28H,3-4,8,10-12H2,(H,22,27) |
| InChIKey | QKGJLFASRUAYTG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 148.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|