C22H29N3O8S — CID 175258577
2-[4-[3-[3-hydroxy-4-(1,1,4-trihydroxy-1,2,5-thiadiazolidin-2-yl)phenyl]propanoylamino]butoxy]benzoic acid (PubChem CID 175258577) has the molecular formula C22H29N3O8S and a molecular weight of 495.55 g/mol. Its IUPAC name is 2-[4-[3-[3-hydroxy-4-(1,1,4-trihydroxy-1,2,5-thiadiazolidin-2-yl)phenyl]propanoylamino]butoxy]benzoic acid.
| Compound Name | 2-[4-[3-[3-hydroxy-4-(1,1,4-trihydroxy-1,2,5-thiadiazolidin-2-yl)phenyl]propanoylamino]butoxy]benzoic acid |
|---|---|
| PubChem CID | 175258577 |
| Molecular Formula | C22H29N3O8S |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | 2-[4-[3-[3-hydroxy-4-(1,1,4-trihydroxy-1,2,5-thiadiazolidin-2-yl)phenyl]propanoylamino]butoxy]benzoic acid |
| SMILES | O=C(CCc1ccc(N2CC(O)NS2(O)O)c(O)c1)NCCCCOc1ccccc1C(=O)O |
| InChI | InChI=1S/C22H29N3O8S/c26-18-13-15(7-9-17(18)25-14-21(28)24-34(25,31)32)8-10-20(27)23-11-3-4-12-33-19-6-2-1-5-16(19)22(29)30/h1-2,5-7,9,13,21,24,26,28,31-32H,3-4,8,10-12,14H2,(H,23,27)(H,29,30) |
| InChIKey | KWIKHPCZPIOPCT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 171.82 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|