C22H24F3N3O6S — CID 68554358
3-[3-hydroxy-4-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl]-N-[4-[2-(trifluoromethyl)phenoxy]butyl]propanamide (PubChem CID 68554358) has the molecular formula C22H24F3N3O6S and a molecular weight of 515.51 g/mol. Its IUPAC name is 3-[3-hydroxy-4-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl]-N-[4-[2-(trifluoromethyl)phenoxy]butyl]propanamide.
| Compound Name | 3-[3-hydroxy-4-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl]-N-[4-[2-(trifluoromethyl)phenoxy]butyl]propanamide |
|---|---|
| PubChem CID | 68554358 |
| Molecular Formula | C22H24F3N3O6S |
| Molecular Weight | 515.51 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | 3-[3-hydroxy-4-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl]-N-[4-[2-(trifluoromethyl)phenoxy]butyl]propanamide |
| SMILES | O=C(CCc1ccc(N2CC(=O)NS2(=O)=O)c(O)c1)NCCCCOc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C22H24F3N3O6S/c23-22(24,25)16-5-1-2-6-19(16)34-12-4-3-11-26-20(30)10-8-15-7-9-17(18(29)13-15)28-14-21(31)27-35(28,32)33/h1-2,5-7,9,13,29H,3-4,8,10-12,14H2,(H,26,30)(H,27,31) |
| InChIKey | OGGQYJIYAXVZSA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.51 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|