C18H20N4O5S — CID 68556328
1-[3-[3-hydroxy-4-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl]propyl]-3-phenylurea (PubChem CID 68556328) has the molecular formula C18H20N4O5S and a molecular weight of 404.45 g/mol. Its IUPAC name is 1-[3-[3-hydroxy-4-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl]propyl]-3-phenylurea.
| Compound Name | 1-[3-[3-hydroxy-4-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl]propyl]-3-phenylurea |
|---|---|
| PubChem CID | 68556328 |
| Molecular Formula | C18H20N4O5S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 1-[3-[3-hydroxy-4-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl]propyl]-3-phenylurea |
| SMILES | O=C1CN(c2ccc(CCCNC(=O)Nc3ccccc3)cc2O)S(=O)(=O)N1 |
| InChI | InChI=1S/C18H20N4O5S/c23-16-11-13(8-9-15(16)22-12-17(24)21-28(22,26)27)5-4-10-19-18(25)20-14-6-2-1-3-7-14/h1-3,6-9,11,23H,4-5,10,12H2,(H,21,24)(H2,19,20,25) |
| InChIKey | XKLXQNFDJNYSEM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|