C18H25N5O9S3 — CID 69090727
5-[2-hydroxy-4-[2-(1-methylsulfonylpiperidin-2-yl)ethyl]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one;1-oxo-1,2,5-thiadiazolidine-3,4-dione (PubChem CID 69090727) has the molecular formula C18H25N5O9S3 and a molecular weight of 551.63 g/mol. Its IUPAC name is 5-[2-hydroxy-4-[2-(1-methylsulfonylpiperidin-2-yl)ethyl]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one;1-oxo-1,2,5-thiadiazolidine-3,4-dione.
| Compound Name | 5-[2-hydroxy-4-[2-(1-methylsulfonylpiperidin-2-yl)ethyl]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one;1-oxo-1,2,5-thiadiazolidine-3,4-dione |
|---|---|
| PubChem CID | 69090727 |
| Molecular Formula | C18H25N5O9S3 |
| Molecular Weight | 551.63 g/mol |
| Exact Mass | 551.08 |
| IUPAC Name | 5-[2-hydroxy-4-[2-(1-methylsulfonylpiperidin-2-yl)ethyl]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one;1-oxo-1,2,5-thiadiazolidine-3,4-dione |
| SMILES | CS(=O)(=O)N1CCCCC1CCc1ccc(N2CC(=O)NS2(=O)=O)c(O)c1.O=C1NS(=O)NC1=O |
| InChI | InChI=1S/C16H23N3O6S2.C2H2N2O3S/c1-26(22,23)18-9-3-2-4-13(18)7-5-12-6-8-14(15(20)10-12)19-11-16(21)17-27(19,24)25;5-1-2(6)4-8(7)3-1/h6,8,10,13,20H,2-5,7,9,11H2,1H3,(H,17,21);(H,3,5)(H,4,6) |
| InChIKey | HKAVJQSPSZGUHH-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 199.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.63 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|