C34H30N6O8S2 — CID 158121834
2-[2-[3-hydroxy-4-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl]ethyl]benzonitrile;4-[2-[3-hydroxy-4-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl]ethyl]benzonitrile (PubChem CID 158121834) has the molecular formula C34H30N6O8S2 and a molecular weight of 714.78 g/mol. Its IUPAC name is 2-[2-[3-hydroxy-4-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl]ethyl]benzonitrile;4-[2-[3-hydroxy-4-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl]ethyl]benzonitrile.
| Compound Name | 2-[2-[3-hydroxy-4-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl]ethyl]benzonitrile;4-[2-[3-hydroxy-4-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl]ethyl]benzonitrile |
|---|---|
| PubChem CID | 158121834 |
| Molecular Formula | C34H30N6O8S2 |
| Molecular Weight | 714.78 g/mol |
| Exact Mass | 714.16 |
| IUPAC Name | 2-[2-[3-hydroxy-4-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl]ethyl]benzonitrile;4-[2-[3-hydroxy-4-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl]ethyl]benzonitrile |
| SMILES | N#Cc1ccc(CCc2ccc(N3CC(=O)NS3(=O)=O)c(O)c2)cc1.N#Cc1ccccc1CCc1ccc(N2CC(=O)NS2(=O)=O)c(O)c1 |
| InChI | InChI=1S/2C17H15N3O4S/c18-10-14-5-2-12(3-6-14)1-4-13-7-8-15(16(21)9-13)20-11-17(22)19-25(20,23)24;18-10-14-4-2-1-3-13(14)7-5-12-6-8-15(16(21)9-12)20-11-17(22)19-25(20,23)24/h2-3,5-9,21H,1,4,11H2,(H,19,22);1-4,6,8-9,21H,5,7,11H2,(H,19,22) |
| InChIKey | FRRWBBAMYNOLTH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 221.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.78 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |