C16H22N2O5S — CID 159006147
5-[2-hydroxy-4-(3-oxooctyl)phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 159006147) has the molecular formula C16H22N2O5S and a molecular weight of 354.43 g/mol. Its IUPAC name is 5-[2-hydroxy-4-(3-oxooctyl)phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[2-hydroxy-4-(3-oxooctyl)phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 159006147 |
| Molecular Formula | C16H22N2O5S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 5-[2-hydroxy-4-(3-oxooctyl)phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | CCCCCC(=O)CCc1ccc(N2CC(=O)NS2(=O)=O)c(O)c1 |
| InChI | InChI=1S/C16H22N2O5S/c1-2-3-4-5-13(19)8-6-12-7-9-14(15(20)10-12)18-11-16(21)17-24(18,22)23/h7,9-10,20H,2-6,8,11H2,1H3,(H,17,21) |
| InChIKey | JRYDLFOJQPFXQV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|