C17H29N3O5S — CID 174578487
N-hexyl-3-[3-hydroxy-4-(1,1,4-trihydroxy-1,2,5-thiadiazolidin-2-yl)phenyl]propanamide (PubChem CID 174578487) has the molecular formula C17H29N3O5S and a molecular weight of 387.50 g/mol. Its IUPAC name is N-hexyl-3-[3-hydroxy-4-(1,1,4-trihydroxy-1,2,5-thiadiazolidin-2-yl)phenyl]propanamide.
| Compound Name | N-hexyl-3-[3-hydroxy-4-(1,1,4-trihydroxy-1,2,5-thiadiazolidin-2-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 174578487 |
| Molecular Formula | C17H29N3O5S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | N-hexyl-3-[3-hydroxy-4-(1,1,4-trihydroxy-1,2,5-thiadiazolidin-2-yl)phenyl]propanamide |
| SMILES | CCCCCCNC(=O)CCc1ccc(N2CC(O)NS2(O)O)c(O)c1 |
| InChI | InChI=1S/C17H29N3O5S/c1-2-3-4-5-10-18-16(22)9-7-13-6-8-14(15(21)11-13)20-12-17(23)19-26(20,24)25/h6,8,11,17,19,21,23-25H,2-5,7,9-10,12H2,1H3,(H,18,22) |
| InChIKey | NJLGARBFVGRRBB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 125.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|